C22H22N4O2 — CID 176913872
3-[4-(4-methylpiperazin-1-yl)anilino]-2H-[1]benzofuro[2,3-c]pyridin-7-one (PubChem CID 176913872) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[4-(4-methylpiperazin-1-yl)anilino]-2H-[1]benzofuro[2,3-c]pyridin-7-one.
| Compound Name | 3-[4-(4-methylpiperazin-1-yl)anilino]-2H-[1]benzofuro[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 176913872 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[4-(4-methylpiperazin-1-yl)anilino]-2H-[1]benzofuro[2,3-c]pyridin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3cc4c(c[nH]3)oc3cc(=O)ccc34)cc2)CC1 |
| InChI | InChI=1S/C22H22N4O2/c1-25-8-10-26(11-9-25)16-4-2-15(3-5-16)24-22-13-19-18-7-6-17(27)12-20(18)28-21(19)14-23-22/h2-7,12-14,23-24H,8-11H2,1H3 |
| InChIKey | KYRZJYLQLJFCIU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|