C15H21N7O — CID 7541198
4-amino-6-methyl-3-[4-(4-methylpiperazin-1-yl)anilino]-1,2,4-triazin-5-one (PubChem CID 7541198) has the molecular formula C15H21N7O and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-amino-6-methyl-3-[4-(4-methylpiperazin-1-yl)anilino]-1,2,4-triazin-5-one.
| Compound Name | 4-amino-6-methyl-3-[4-(4-methylpiperazin-1-yl)anilino]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 7541198 |
| Molecular Formula | C15H21N7O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-amino-6-methyl-3-[4-(4-methylpiperazin-1-yl)anilino]-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(Nc2ccc(N3CCN(C)CC3)cc2)n(N)c1=O |
| InChI | InChI=1S/C15H21N7O/c1-11-14(23)22(16)15(19-18-11)17-12-3-5-13(6-4-12)21-9-7-20(2)8-10-21/h3-6H,7-10,16H2,1-2H3,(H,17,19) |
| InChIKey | ZDPKJYCSGSAOPU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|