C18H22N6 — CID 59618833
3-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrazolo[4,3-c]pyridin-4-amine (PubChem CID 59618833) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 3-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrazolo[4,3-c]pyridin-4-amine.
| Compound Name | 3-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrazolo[4,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 59618833 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-2H-pyrazolo[4,3-c]pyridin-4-amine |
| SMILES | Cc1[nH]nc2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)c12 |
| InChI | InChI=1S/C18H22N6/c1-13-17-16(22-21-13)7-8-19-18(17)20-14-3-5-15(6-4-14)24-11-9-23(2)10-12-24/h3-8H,9-12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | OUGZHPGQCMDLBF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|