C15H21N5 — CID 123924900
N-[4-(4-methylpiperazin-1-yl)phenyl]-4,5-dihydropyrimidin-2-amine (PubChem CID 123924900) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4,5-dihydropyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4,5-dihydropyrimidin-2-amine |
|---|---|
| PubChem CID | 123924900 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4,5-dihydropyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(NC3=NCCC=N3)cc2)CC1 |
| InChI | InChI=1S/C15H21N5/c1-19-9-11-20(12-10-19)14-5-3-13(4-6-14)18-15-16-7-2-8-17-15/h3-7H,2,8-12H2,1H3,(H,17,18) |
| InChIKey | CCINDCLCQZUXGG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|