C26H26N6O3 — CID 171622477
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-oxo-2H-isoquinolin-6-yl)amino]-1H-pyridine-3-carboxamide (PubChem CID 171622477) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-oxo-2H-isoquinolin-6-yl)amino]-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-oxo-2H-isoquinolin-6-yl)amino]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622477 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-oxo-2H-isoquinolin-6-yl)amino]-1H-pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(Nc4ccc5c(=O)[nH]ccc5c4)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C26H26N6O3/c1-31-12-14-32(15-13-31)20-5-2-18(3-6-20)30-26(35)23-22(9-11-28-25(23)34)29-19-4-7-21-17(16-19)8-10-27-24(21)33/h2-11,16H,12-15H2,1H3,(H,27,33)(H,30,35)(H2,28,29,34) |
| InChIKey | KRAIYFSKVYRZED-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|