C23H23F3N6O3 — CID 171622784
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[[3-(trifluoromethoxy)-2-pyridinyl]amino]-1H-pyridine-3-carboxamide (PubChem CID 171622784) has the molecular formula C23H23F3N6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[[3-(trifluoromethoxy)-2-pyridinyl]amino]-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[[3-(trifluoromethoxy)-2-pyridinyl]amino]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622784 |
| Molecular Formula | C23H23F3N6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[[3-(trifluoromethoxy)-2-pyridinyl]amino]-1H-pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(Nc4ncccc4OC(F)(F)F)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C23H23F3N6O3/c1-31-11-13-32(14-12-31)16-6-4-15(5-7-16)29-22(34)19-17(8-10-28-21(19)33)30-20-18(3-2-9-27-20)35-23(24,25)26/h2-10H,11-14H2,1H3,(H,29,34)(H2,27,28,30,33) |
| InChIKey | CUXZQDZXLBQGFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|