C24H29N7O3 — CID 171622534
N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171622534) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622534 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | COCCN1CCN(c2ccc(NC(=O)c3c(Nc4nnccc4C)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C24H29N7O3/c1-17-7-10-26-29-22(17)28-20-8-9-25-23(32)21(20)24(33)27-18-3-5-19(6-4-18)31-13-11-30(12-14-31)15-16-34-2/h3-10H,11-16H2,1-2H3,(H,27,33)(H2,25,28,29,32) |
| InChIKey | GQUGCCDAOYTOIH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|