C25H31N7O3 — CID 171622574
N-[4-[4-(3-methoxypropyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171622574) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[4-[4-(3-methoxypropyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-[4-(3-methoxypropyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622574 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | N-[4-[4-(3-methoxypropyl)piperazin-1-yl]phenyl]-4-[(4-methylpyridazin-3-yl)amino]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | COCCCN1CCN(c2ccc(NC(=O)c3c(Nc4nnccc4C)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C25H31N7O3/c1-18-8-11-27-30-23(18)29-21-9-10-26-24(33)22(21)25(34)28-19-4-6-20(7-5-19)32-15-13-31(14-16-32)12-3-17-35-2/h4-11H,3,12-17H2,1-2H3,(H,28,34)(H2,26,29,30,33) |
| InChIKey | MICIWKLAVAYOBE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|