C25H27N5O4 — CID 171622693
4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171622693) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622693 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(Nc4ccc5c(c4)OCCO5)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C25H27N5O4/c1-29-10-12-30(13-11-29)19-5-2-17(3-6-19)28-25(32)23-20(8-9-26-24(23)31)27-18-4-7-21-22(16-18)34-15-14-33-21/h2-9,16H,10-15H2,1H3,(H,28,32)(H2,26,27,31) |
| InChIKey | HGUAOMCCGVKZST-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|