C25H36N6O2 — CID 171622618
4-[[4-(dimethylamino)cyclohexyl]amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171622618) has the molecular formula C25H36N6O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)cyclohexyl]amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 4-[[4-(dimethylamino)cyclohexyl]amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622618 |
| Molecular Formula | C25H36N6O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 4-[[4-(dimethylamino)cyclohexyl]amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(NC4CCC(N(C)C)CC4)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C25H36N6O2/c1-29(2)20-8-4-18(5-9-20)27-22-12-13-26-24(32)23(22)25(33)28-19-6-10-21(11-7-19)31-16-14-30(3)15-17-31/h6-7,10-13,18,20H,4-5,8-9,14-17H2,1-3H3,(H,28,33)(H2,26,27,32) |
| InChIKey | ZBJGXTOKGGXUBA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|