C22H30N6O3 — CID 171622536
4-[(4-hydroxycyclohexyl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 171622536) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[(4-hydroxycyclohexyl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-[(4-hydroxycyclohexyl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 171622536 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-[(4-hydroxycyclohexyl)amino]-N-[4-(4-methylpiperazin-1-yl)phenyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(NC4CCC(O)CC4)nc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C22H30N6O3/c1-27-10-12-28(13-11-27)17-6-2-16(3-7-17)26-22(31)19-20(23-14-24-21(19)30)25-15-4-8-18(29)9-5-15/h2-3,6-7,14-15,18,29H,4-5,8-13H2,1H3,(H,26,31)(H2,23,24,25,30) |
| InChIKey | UWIDZOGPJUOFOD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|