C28H34N6O2 — CID 171622753
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-phenylpiperidin-4-yl)amino]-1H-pyridine-3-carboxamide (PubChem CID 171622753) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-phenylpiperidin-4-yl)amino]-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-phenylpiperidin-4-yl)amino]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622753 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-4-[(1-phenylpiperidin-4-yl)amino]-1H-pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3c(NC4CCN(c5ccccc5)CC4)cc[nH]c3=O)cc2)CC1 |
| InChI | InChI=1S/C28H34N6O2/c1-32-17-19-34(20-18-32)24-9-7-21(8-10-24)31-28(36)26-25(11-14-29-27(26)35)30-22-12-15-33(16-13-22)23-5-3-2-4-6-23/h2-11,14,22H,12-13,15-20H2,1H3,(H,31,36)(H2,29,30,35) |
| InChIKey | NLLYJJWBJFVQGV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|