C27H28N6O2S — CID 171622457
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 171622457) has the molecular formula C27H28N6O2S and a molecular weight of 500.63 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622457 |
| Molecular Formula | C27H28N6O2S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1nc(-c2cccc(Nc3cc[nH]c(=O)c3C(=O)Nc3ccc(N4CCN(C)CC4)cc3)c2)cs1 |
| InChI | InChI=1S/C27H28N6O2S/c1-18-29-24(17-36-18)19-4-3-5-21(16-19)30-23-10-11-28-26(34)25(23)27(35)31-20-6-8-22(9-7-20)33-14-12-32(2)13-15-33/h3-11,16-17H,12-15H2,1-2H3,(H,31,35)(H2,28,30,34) |
| InChIKey | VKXSNVCYNWPLNX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|