C25H29ClN6O2 — CID 171622694
4-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 171622694) has the molecular formula C25H29ClN6O2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 4-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 4-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622694 |
| Molecular Formula | C25H29ClN6O2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)ncc1Nc1cc[nH]c(=O)c1C(=O)Nc1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H29ClN6O2/c1-16(2)31-10-12-32(13-11-31)19-6-4-18(5-7-19)29-25(34)23-20(8-9-27-24(23)33)30-21-15-28-22(26)14-17(21)3/h4-9,14-16H,10-13H2,1-3H3,(H,29,34)(H2,27,30,33) |
| InChIKey | JSNJIQFWBZXNNA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|