C24H33N7O2 — CID 171622552
4-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 171622552) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 4-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 4-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622552 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 4-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-oxo-N-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | CC(/C=C\N)=C(/N)Nc1cc[nH]c(=O)c1C(=O)Nc1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H33N7O2/c1-16(2)30-12-14-31(15-13-30)19-6-4-18(5-7-19)28-24(33)21-20(9-11-27-23(21)32)29-22(26)17(3)8-10-25/h4-11,16H,12-15,25-26H2,1-3H3,(H,28,33)(H2,27,29,32)/b10-8-,22-17+ |
| InChIKey | JZNBDEBXDYPCLQ-LDVNPLAHSA-N |
| XLogP | 2.23 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|