C19H28NO5P — CID 176917750
tert-butyl 4-[[ethynyl-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phosphoryl]amino]benzoate (PubChem CID 176917750) has the molecular formula C19H28NO5P and a molecular weight of 381.41 g/mol. Its IUPAC name is tert-butyl 4-[[ethynyl-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phosphoryl]amino]benzoate.
| Compound Name | tert-butyl 4-[[ethynyl-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phosphoryl]amino]benzoate |
|---|---|
| PubChem CID | 176917750 |
| Molecular Formula | C19H28NO5P |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | tert-butyl 4-[[ethynyl-[2-[(2-methylpropan-2-yl)oxy]ethoxy]phosphoryl]amino]benzoate |
| SMILES | C#CP(=O)(Nc1ccc(C(=O)OC(C)(C)C)cc1)OCCOC(C)(C)C |
| InChI | InChI=1S/C19H28NO5P/c1-8-26(22,24-14-13-23-18(2,3)4)20-16-11-9-15(10-12-16)17(21)25-19(5,6)7/h1,9-12H,13-14H2,2-7H3,(H,20,22) |
| InChIKey | UHQDMGPZVCCASE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|