C18H21N2O6PS2 — CID 134318739
(2,5-dioxopyrrolidin-1-yl) 4-[[ethynyl-[2-(propan-2-yldisulfanyl)ethoxy]phosphoryl]amino]benzoate (PubChem CID 134318739) has the molecular formula C18H21N2O6PS2 and a molecular weight of 456.48 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[ethynyl-[2-(propan-2-yldisulfanyl)ethoxy]phosphoryl]amino]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[ethynyl-[2-(propan-2-yldisulfanyl)ethoxy]phosphoryl]amino]benzoate |
|---|---|
| PubChem CID | 134318739 |
| Molecular Formula | C18H21N2O6PS2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[ethynyl-[2-(propan-2-yldisulfanyl)ethoxy]phosphoryl]amino]benzoate |
| SMILES | C#CP(=O)(Nc1ccc(C(=O)ON2C(=O)CCC2=O)cc1)OCCSSC(C)C |
| InChI | InChI=1S/C18H21N2O6PS2/c1-4-27(24,25-11-12-28-29-13(2)3)19-15-7-5-14(6-8-15)18(23)26-20-16(21)9-10-17(20)22/h1,5-8,13H,9-12H2,2-3H3,(H,19,24) |
| InChIKey | RIJUOTFANYAJNH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|