C17H24N2O8P+ — CID 130350593
2-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenoxy]-methoxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 130350593) has the molecular formula C17H24N2O8P+ and a molecular weight of 415.36 g/mol. Its IUPAC name is 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenoxy]-methoxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenoxy]-methoxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 130350593 |
| Molecular Formula | C17H24N2O8P+ |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenoxy]-methoxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | COP(=O)(OCC[N+](C)(C)C)Oc1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H24N2O8P/c1-19(2,3)11-12-25-28(23,24-4)27-14-7-5-13(6-8-14)17(22)26-18-15(20)9-10-16(18)21/h5-8H,9-12H2,1-4H3/q+1 |
| InChIKey | SKDBNWIHLGMBDT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|