C25H24N2O5S — CID 176920451
methyl 3-(8-formyl-4H-thieno[3,2-c]chromen-7-yl)-6-(3-methylbutylcarbamoyl)pyridine-2-carboxylate (PubChem CID 176920451) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is methyl 3-(8-formyl-4H-thieno[3,2-c]chromen-7-yl)-6-(3-methylbutylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-(8-formyl-4H-thieno[3,2-c]chromen-7-yl)-6-(3-methylbutylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 176920451 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 3-(8-formyl-4H-thieno[3,2-c]chromen-7-yl)-6-(3-methylbutylcarbamoyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C(=O)NCCC(C)C)ccc1-c1cc2c(cc1C=O)-c1sccc1CO2 |
| InChI | InChI=1S/C25H24N2O5S/c1-14(2)6-8-26-24(29)20-5-4-17(22(27-20)25(30)31-3)18-11-21-19(10-16(18)12-28)23-15(13-32-21)7-9-33-23/h4-5,7,9-12,14H,6,8,13H2,1-3H3,(H,26,29) |
| InChIKey | DVAKXURTZSMFNC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|