C20H35F2N — CID 176921826
4-[(5E)-6-(difluoromethyl)-3,7-dimethylnona-3,5-dien-4-yl]-1-propylpiperidine (PubChem CID 176921826) has the molecular formula C20H35F2N and a molecular weight of 327.50 g/mol. Its IUPAC name is 4-[(5E)-6-(difluoromethyl)-3,7-dimethylnona-3,5-dien-4-yl]-1-propylpiperidine.
| Compound Name | 4-[(5E)-6-(difluoromethyl)-3,7-dimethylnona-3,5-dien-4-yl]-1-propylpiperidine |
|---|---|
| PubChem CID | 176921826 |
| Molecular Formula | C20H35F2N |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 4-[(5E)-6-(difluoromethyl)-3,7-dimethylnona-3,5-dien-4-yl]-1-propylpiperidine |
| SMILES | CCCN1CCC(C(/C=C(/C(F)F)C(C)CC)=C(C)CC)CC1 |
| InChI | InChI=1S/C20H35F2N/c1-6-11-23-12-9-17(10-13-23)18(15(4)7-2)14-19(20(21)22)16(5)8-3/h14,16-17,20H,6-13H2,1-5H3/b18-15?,19-14+ |
| InChIKey | BWNDTPIPFGKCNV-ZIFYTEAUSA-N |
| XLogP | 6.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|