C8H17N — CID 176921885
molecular hydrogen;(1Z)-N,2,4-trimethylpenta-1,3-dien-1-amine (PubChem CID 176921885) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is molecular hydrogen;(1Z)-N,2,4-trimethylpenta-1,3-dien-1-amine.
| Compound Name | molecular hydrogen;(1Z)-N,2,4-trimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 176921885 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | molecular hydrogen;(1Z)-N,2,4-trimethylpenta-1,3-dien-1-amine |
| SMILES | CN/C=C(/C)C=C(C)C.[H][H] |
| InChI | InChI=1S/C8H15N.H2/c1-7(2)5-8(3)6-9-4;/h5-6,9H,1-4H3;1H/b8-6-; |
| InChIKey | XLEUODIGHLTPKM-PHZXCRFESA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|