C12H10F2N2O2 — CID 176922321
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dimethylpyrazole (PubChem CID 176922321) has the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dimethylpyrazole.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 176922321 |
| Molecular Formula | C12H10F2N2O2 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(-c2ccc3c(c2)OC(F)(F)O3)n1 |
| InChI | InChI=1S/C12H10F2N2O2/c1-7-5-8(2)16(15-7)9-3-4-10-11(6-9)18-12(13,14)17-10/h3-6H,1-2H3 |
| InChIKey | YUWLSVRUUWNZHA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |