C19H21N — CID 176922425
N-methyl-N-[(2Z)-4-methylhepta-2,4,5-trien-2-yl]naphthalen-2-amine (PubChem CID 176922425) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-methyl-N-[(2Z)-4-methylhepta-2,4,5-trien-2-yl]naphthalen-2-amine.
| Compound Name | N-methyl-N-[(2Z)-4-methylhepta-2,4,5-trien-2-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 176922425 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-methyl-N-[(2Z)-4-methylhepta-2,4,5-trien-2-yl]naphthalen-2-amine |
| SMILES | CC=C=C(C)/C=C(/C)N(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H21N/c1-5-8-15(2)13-16(3)20(4)19-12-11-17-9-6-7-10-18(17)14-19/h5-7,9-14H,1-4H3/b16-13- |
| InChIKey | AFBUMTLENFRRDK-SSZFMOIBSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|