C15H18N6O — CID 176922666
N'-[7-(5-cyano-5-methyloxolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 176922666) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N'-[7-(5-cyano-5-methyloxolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-(5-cyano-5-methyloxolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 176922666 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N'-[7-(5-cyano-5-methyloxolan-2-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ncnn2c(C3CCC(C)(C#N)O3)ccc12 |
| InChI | InChI=1S/C15H18N6O/c1-15(8-16)7-6-13(22-15)11-4-5-12-14(18-10-20(2)3)17-9-19-21(11)12/h4-5,9-10,13H,6-7H2,1-3H3/b18-10+ |
| InChIKey | OMPMTBHUXJJKNP-VCHYOVAHSA-N |
| XLogP | 2.08 |
| TPSA | 78.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|