C28H30Cl2F2N6O2 — CID 176924407
6-benzyl-4-[[2-(3,6-dichloro-1,2,4-triazin-5-yl)-2-azaspiro[3.3]heptan-6-yl]oxy]-5-[3-(difluoromethoxy)propyl]-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 176924407) has the molecular formula C28H30Cl2F2N6O2 and a molecular weight of 591.49 g/mol. Its IUPAC name is 6-benzyl-4-[[2-(3,6-dichloro-1,2,4-triazin-5-yl)-2-azaspiro[3.3]heptan-6-yl]oxy]-5-[3-(difluoromethoxy)propyl]-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 6-benzyl-4-[[2-(3,6-dichloro-1,2,4-triazin-5-yl)-2-azaspiro[3.3]heptan-6-yl]oxy]-5-[3-(difluoromethoxy)propyl]-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 176924407 |
| Molecular Formula | C28H30Cl2F2N6O2 |
| Molecular Weight | 591.49 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 6-benzyl-4-[[2-(3,6-dichloro-1,2,4-triazin-5-yl)-2-azaspiro[3.3]heptan-6-yl]oxy]-5-[3-(difluoromethoxy)propyl]-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | FC(F)OCCCC1c2c(OC3CC4(C3)CN(c3nc(Cl)nnc3Cl)C4)ccnc2CCN1Cc1ccccc1 |
| InChI | InChI=1S/C28H30Cl2F2N6O2/c29-24-25(34-26(30)36-35-24)38-16-28(17-38)13-19(14-28)40-22-8-10-33-20-9-11-37(15-18-5-2-1-3-6-18)21(23(20)22)7-4-12-39-27(31)32/h1-3,5-6,8,10,19,21,27H,4,7,9,11-17H2 |
| InChIKey | JEJYEHDUYZSRGT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|