C11H13FO — CID 176929353
6-fluoro-1-methoxy-5-methyl-2,3-dihydro-1H-indene (PubChem CID 176929353) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is 6-fluoro-1-methoxy-5-methyl-2,3-dihydro-1H-indene.
| Compound Name | 6-fluoro-1-methoxy-5-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 176929353 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 6-fluoro-1-methoxy-5-methyl-2,3-dihydro-1H-indene |
| SMILES | COC1CCc2cc(C)c(F)cc21 |
| InChI | InChI=1S/C11H13FO/c1-7-5-8-3-4-11(13-2)9(8)6-10(7)12/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | SWURTDAKDHVDFT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |