C20H28F2N2O3 — CID 176939586
methyl 4-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)-5-(2-methoxyethylamino)-2-methylbenzoate (PubChem CID 176939586) has the molecular formula C20H28F2N2O3 and a molecular weight of 382.45 g/mol. Its IUPAC name is methyl 4-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)-5-(2-methoxyethylamino)-2-methylbenzoate.
| Compound Name | methyl 4-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)-5-(2-methoxyethylamino)-2-methylbenzoate |
|---|---|
| PubChem CID | 176939586 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 4-(2,2-difluoro-7-azaspiro[3.5]nonan-6-yl)-5-(2-methoxyethylamino)-2-methylbenzoate |
| SMILES | COCCNc1cc(C(=O)OC)c(C)cc1C1CC2(CCN1)CC(F)(F)C2 |
| InChI | InChI=1S/C20H28F2N2O3/c1-13-8-15(16(24-6-7-26-2)9-14(13)18(25)27-3)17-10-19(4-5-23-17)11-20(21,22)12-19/h8-9,17,23-24H,4-7,10-12H2,1-3H3 |
| InChIKey | WBBBHXMVPWTHHT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|