C20H26ClN3O2 — CID 118250742
methyl 4-cyclobutyl-5-(1,4,5,6,7,8-hexahydroimidazo[4,5-d]azepin-2-yl)-2-methylbenzoate;hydrochloride (PubChem CID 118250742) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is methyl 4-cyclobutyl-5-(1,4,5,6,7,8-hexahydroimidazo[4,5-d]azepin-2-yl)-2-methylbenzoate;hydrochloride.
| Compound Name | methyl 4-cyclobutyl-5-(1,4,5,6,7,8-hexahydroimidazo[4,5-d]azepin-2-yl)-2-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 118250742 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | methyl 4-cyclobutyl-5-(1,4,5,6,7,8-hexahydroimidazo[4,5-d]azepin-2-yl)-2-methylbenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(-c2nc3c([nH]2)CCNCC3)c(C2CCC2)cc1C.Cl |
| InChI | InChI=1S/C20H25N3O2.ClH/c1-12-10-15(13-4-3-5-13)16(11-14(12)20(24)25-2)19-22-17-6-8-21-9-7-18(17)23-19;/h10-11,13,21H,3-9H2,1-2H3,(H,22,23);1H |
| InChIKey | QKGMZYDIKDRGND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |