C8H6ClF3N4 — CID 176940054
2-chloro-N'-methanimidoyl-5-(trifluoromethyl)pyridine-4-carboximidamide (PubChem CID 176940054) has the molecular formula C8H6ClF3N4 and a molecular weight of 250.61 g/mol. Its IUPAC name is 2-chloro-N'-methanimidoyl-5-(trifluoromethyl)pyridine-4-carboximidamide.
| Compound Name | 2-chloro-N'-methanimidoyl-5-(trifluoromethyl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 176940054 |
| Molecular Formula | C8H6ClF3N4 |
| Molecular Weight | 250.61 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-chloro-N'-methanimidoyl-5-(trifluoromethyl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1cc(Cl)ncc1C(F)(F)F |
| InChI | InChI=1S/C8H6ClF3N4/c9-6-1-4(7(14)16-3-13)5(2-15-6)8(10,11)12/h1-3H,(H3,13,14,16) |
| InChIKey | CKTBJDJAEDRDGK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.61 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|