C9H10F3N5 — CID 176940110
2-amino-N'-(methyliminomethyl)-5-(trifluoromethyl)pyridine-4-carboximidamide (PubChem CID 176940110) has the molecular formula C9H10F3N5 and a molecular weight of 245.21 g/mol. Its IUPAC name is 2-amino-N'-(methyliminomethyl)-5-(trifluoromethyl)pyridine-4-carboximidamide.
| Compound Name | 2-amino-N'-(methyliminomethyl)-5-(trifluoromethyl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 176940110 |
| Molecular Formula | C9H10F3N5 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-amino-N'-(methyliminomethyl)-5-(trifluoromethyl)pyridine-4-carboximidamide |
| SMILES | C/N=C/N=C(\N)c1cc(N)ncc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3N5/c1-15-4-17-8(14)5-2-7(13)16-3-6(5)9(10,11)12/h2-4H,1H3,(H2,13,16)(H2,14,15,17) |
| InChIKey | KMQQQVZCICQLOY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|