C34H42F2N4O4 — CID 176942177
acetylene;1-[4-(4-cyclobutyl-2-hydroxy-N-methylanilino)-1-[6-(difluoromethoxy)pyridine-3-carbonyl]-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one;ethane (PubChem CID 176942177) has the molecular formula C34H42F2N4O4 and a molecular weight of 608.73 g/mol. Its IUPAC name is acetylene;1-[4-(4-cyclobutyl-2-hydroxy-N-methylanilino)-1-[6-(difluoromethoxy)pyridine-3-carbonyl]-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one;ethane.
| Compound Name | acetylene;1-[4-(4-cyclobutyl-2-hydroxy-N-methylanilino)-1-[6-(difluoromethoxy)pyridine-3-carbonyl]-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 176942177 |
| Molecular Formula | C34H42F2N4O4 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | acetylene;1-[4-(4-cyclobutyl-2-hydroxy-N-methylanilino)-1-[6-(difluoromethoxy)pyridine-3-carbonyl]-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one;ethane |
| SMILES | C#C.C=CC(=O)N1CCCC2=C(N(C)c3ccc(C4CCC4)cc3O)CCN(C(=O)c3ccc(OC(F)F)nc3)C2C1.CC |
| InChI | InChI=1S/C30H34F2N4O4.C2H6.C2H2/c1-3-28(38)35-14-5-8-22-23(34(2)24-11-9-20(16-26(24)37)19-6-4-7-19)13-15-36(25(22)18-35)29(39)21-10-12-27(33-17-21)40-30(31)32;2*1-2/h3,9-12,16-17,19,25,30,37H,1,4-8,13-15,18H2,2H3;1-2H3;1-2H |
| InChIKey | SWUPLRZTUBEGSG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|