C23H21ClF2N4O2 — CID 166540084
1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]quinazolin-6-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166540084) has the molecular formula C23H21ClF2N4O2 and a molecular weight of 458.90 g/mol. Its IUPAC name is 1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]quinazolin-6-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]quinazolin-6-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166540084 |
| Molecular Formula | C23H21ClF2N4O2 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]quinazolin-6-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(c2ccc3ncnc(Nc4ccc(OC(F)F)c(Cl)c4)c3c2)C1 |
| InChI | InChI=1S/C23H21ClF2N4O2/c1-2-21(31)30-9-3-4-15(12-30)14-5-7-19-17(10-14)22(28-13-27-19)29-16-6-8-20(18(24)11-16)32-23(25)26/h2,5-8,10-11,13,15,23H,1,3-4,9,12H2,(H,27,28,29) |
| InChIKey | BGCHWGJBZIBSEC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|