C23H21ClF2N4O3 — CID 166539123
1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]-7-methoxyquinazolin-6-yl]-3-methylazetidin-1-yl]prop-2-en-1-one (PubChem CID 166539123) has the molecular formula C23H21ClF2N4O3 and a molecular weight of 474.90 g/mol. Its IUPAC name is 1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]-7-methoxyquinazolin-6-yl]-3-methylazetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]-7-methoxyquinazolin-6-yl]-3-methylazetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166539123 |
| Molecular Formula | C23H21ClF2N4O3 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 1-[3-[4-[3-chloro-4-(difluoromethoxy)anilino]-7-methoxyquinazolin-6-yl]-3-methylazetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)(c2cc3c(Nc4ccc(OC(F)F)c(Cl)c4)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C23H21ClF2N4O3/c1-4-20(31)30-10-23(2,11-30)15-8-14-17(9-19(15)32-3)27-12-28-21(14)29-13-5-6-18(16(24)7-13)33-22(25)26/h4-9,12,22H,1,10-11H2,2-3H3,(H,27,28,29) |
| InChIKey | MZHMFHQPUJPBBX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|