C32H38F2N4O3 — CID 176942897
1-[4-(4-cyclobutyl-2-hydroxyanilino)-1-[6-(1,1-difluoroethyl)pyridine-3-carbonyl]-5-ethyl-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one (PubChem CID 176942897) has the molecular formula C32H38F2N4O3 and a molecular weight of 564.68 g/mol. Its IUPAC name is 1-[4-(4-cyclobutyl-2-hydroxyanilino)-1-[6-(1,1-difluoroethyl)pyridine-3-carbonyl]-5-ethyl-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(4-cyclobutyl-2-hydroxyanilino)-1-[6-(1,1-difluoroethyl)pyridine-3-carbonyl]-5-ethyl-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176942897 |
| Molecular Formula | C32H38F2N4O3 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 1-[4-(4-cyclobutyl-2-hydroxyanilino)-1-[6-(1,1-difluoroethyl)pyridine-3-carbonyl]-5-ethyl-3,5,6,7,9,9a-hexahydro-2H-pyrido[2,3-c]azepin-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(CC)C2=C(Nc3ccc(C4CCC4)cc3O)CCN(C(=O)c3ccc(C(C)(F)F)nc3)C2C1 |
| InChI | InChI=1S/C32H38F2N4O3/c1-4-20-13-15-37(29(40)5-2)19-26-30(20)25(36-24-11-9-22(17-27(24)39)21-7-6-8-21)14-16-38(26)31(41)23-10-12-28(35-18-23)32(3,33)34/h5,9-12,17-18,20-21,26,36,39H,2,4,6-8,13-16,19H2,1,3H3 |
| InChIKey | XGZBYFUZTDBAIL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|