C16H23F3N4O2S — CID 176945748
(2'S,4S,6'S,7S)-2'-[(Z)-1-hydrazinyl-2-(methylamino)ethenyl]-6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol (PubChem CID 176945748) has the molecular formula C16H23F3N4O2S and a molecular weight of 392.45 g/mol. Its IUPAC name is (2'S,4S,6'S,7S)-2'-[(Z)-1-hydrazinyl-2-(methylamino)ethenyl]-6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol.
| Compound Name | (2'S,4S,6'S,7S)-2'-[(Z)-1-hydrazinyl-2-(methylamino)ethenyl]-6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 176945748 |
| Molecular Formula | C16H23F3N4O2S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2'S,4S,6'S,7S)-2'-[(Z)-1-hydrazinyl-2-(methylamino)ethenyl]-6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
| SMILES | CN/C=C(\NN)[C@@H]1C[C@]2(C[C@H](C)N1)OC[C@@H](O)c1cc(C(F)(F)F)sc12 |
| InChI | InChI=1S/C16H23F3N4O2S/c1-8-4-15(5-10(22-8)11(23-20)6-21-2)14-9(12(24)7-25-15)3-13(26-14)16(17,18)19/h3,6,8,10,12,21-24H,4-5,7,20H2,1-2H3/b11-6-/t8-,10-,12+,15-/m0/s1 |
| InChIKey | LQTRSTTYMSIPBU-SYGYRHBRSA-N |
| XLogP | 1.69 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|