C19H20ClN5O3S — CID 176951876
7-(2-chloro-3-methoxy-6-methylphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene;ethane (PubChem CID 176951876) has the molecular formula C19H20ClN5O3S and a molecular weight of 433.92 g/mol. Its IUPAC name is 7-(2-chloro-3-methoxy-6-methylphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene;ethane.
| Compound Name | 7-(2-chloro-3-methoxy-6-methylphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene;ethane |
|---|---|
| PubChem CID | 176951876 |
| Molecular Formula | C19H20ClN5O3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 7-(2-chloro-3-methoxy-6-methylphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene;ethane |
| SMILES | CC.COc1ccc(C)c(-c2cc3cnc(S(C)(=O)=O)nc3n3cnnc23)c1Cl |
| InChI | InChI=1S/C17H14ClN5O3S.C2H6/c1-9-4-5-12(26-2)14(18)13(9)11-6-10-7-19-17(27(3,24)25)21-15(10)23-8-20-22-16(11)23;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | IEAGHLBYKKZPJM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 99.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |