C29H37ClN7O7S+ — CID 158559713
tert-butyl 4-[3-[7-(2-chloro-3,5-dimethoxyphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl]propyl]-4-hydroxypiperazin-4-ium-1-carboxylate (PubChem CID 158559713) has the molecular formula C29H37ClN7O7S+ and a molecular weight of 663.18 g/mol. Its IUPAC name is tert-butyl 4-[3-[7-(2-chloro-3,5-dimethoxyphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl]propyl]-4-hydroxypiperazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[7-(2-chloro-3,5-dimethoxyphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl]propyl]-4-hydroxypiperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 158559713 |
| Molecular Formula | C29H37ClN7O7S+ |
| Molecular Weight | 663.18 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | tert-butyl 4-[3-[7-(2-chloro-3,5-dimethoxyphenyl)-12-methylsulfonyl-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-3-yl]propyl]-4-hydroxypiperazin-4-ium-1-carboxylate |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(S(C)(=O)=O)nc3n3c(CCC[N+]4(O)CCN(C(=O)OC(C)(C)C)CC4)nnc23)c1 |
| InChI | InChI=1S/C29H37ClN7O7S/c1-29(2,3)44-28(38)35-9-12-37(39,13-10-35)11-7-8-23-33-34-26-21(20-15-19(42-4)16-22(43-5)24(20)30)14-18-17-31-27(45(6,40)41)32-25(18)36(23)26/h14-17,39H,7-13H2,1-6H3/q+1 |
| InChIKey | JYQUQGFPKDSJEO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|