C23H27N5O3 — CID 131748432
tert-butyl 4-[6-(6-methoxyisoquinolin-7-yl)pyridazin-3-yl]piperazine-1-carboxylate (PubChem CID 131748432) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is tert-butyl 4-[6-(6-methoxyisoquinolin-7-yl)pyridazin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(6-methoxyisoquinolin-7-yl)pyridazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 131748432 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | tert-butyl 4-[6-(6-methoxyisoquinolin-7-yl)pyridazin-3-yl]piperazine-1-carboxylate |
| SMILES | COc1cc2ccncc2cc1-c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)nn1 |
| InChI | InChI=1S/C23H27N5O3/c1-23(2,3)31-22(29)28-11-9-27(10-12-28)21-6-5-19(25-26-21)18-13-17-15-24-8-7-16(17)14-20(18)30-4/h5-8,13-15H,9-12H2,1-4H3 |
| InChIKey | PYWMYLZNELAYDH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |