C22H26N6O3 — CID 139270457
tert-butyl 4-[6-(2-hydroxy-4-pyrazol-1-ylphenyl)pyridazin-3-yl]piperazine-1-carboxylate (PubChem CID 139270457) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is tert-butyl 4-[6-(2-hydroxy-4-pyrazol-1-ylphenyl)pyridazin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-(2-hydroxy-4-pyrazol-1-ylphenyl)pyridazin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139270457 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | tert-butyl 4-[6-(2-hydroxy-4-pyrazol-1-ylphenyl)pyridazin-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-c3ccc(-n4cccn4)cc3O)nn2)CC1 |
| InChI | InChI=1S/C22H26N6O3/c1-22(2,3)31-21(30)27-13-11-26(12-14-27)20-8-7-18(24-25-20)17-6-5-16(15-19(17)29)28-10-4-9-23-28/h4-10,15,29H,11-14H2,1-3H3 |
| InChIKey | WMUPLIYNLMCCHV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |