C26H25F3N4O6 — CID 176953366
methyl 4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]phenyl]benzoate (PubChem CID 176953366) has the molecular formula C26H25F3N4O6 and a molecular weight of 546.50 g/mol. Its IUPAC name is methyl 4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]phenyl]benzoate.
| Compound Name | methyl 4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 176953366 |
| Molecular Formula | C26H25F3N4O6 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | methyl 4-[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C(=O)NC[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C26H25F3N4O6/c1-38-25(37)17-8-4-15(5-9-17)14-2-6-16(7-3-14)24(36)31-10-19-23(35)22(34)18(13-39-19)32-21-12-30-11-20(33-21)26(27,28)29/h2-9,11-12,18-19,22-23,34-35H,10,13H2,1H3,(H,31,36)(H,32,33)/t18-,19+,22+,23-/m0/s1 |
| InChIKey | HBWMOAGKIHVKKA-CSGUBPAMSA-N |
| XLogP | 2.28 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |