C20H31F3N5O4+ — CID 176953374
[(E)-2-[(3,4-dihydroxyoxan-2-yl)methylcarbamoyl]but-2-enylidene]-methyl-propan-2-ylazanium;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 176953374) has the molecular formula C20H31F3N5O4+ and a molecular weight of 462.49 g/mol. Its IUPAC name is [(E)-2-[(3,4-dihydroxyoxan-2-yl)methylcarbamoyl]but-2-enylidene]-methyl-propan-2-ylazanium;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | [(E)-2-[(3,4-dihydroxyoxan-2-yl)methylcarbamoyl]but-2-enylidene]-methyl-propan-2-ylazanium;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 176953374 |
| Molecular Formula | C20H31F3N5O4+ |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [(E)-2-[(3,4-dihydroxyoxan-2-yl)methylcarbamoyl]but-2-enylidene]-methyl-propan-2-ylazanium;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | C/C=C(\C=[N+](/C)C(C)C)C(=O)NCC1OCCC(O)C1O.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H26N2O4.C5H4F3N3/c1-5-11(9-17(4)10(2)3)15(20)16-8-13-14(19)12(18)6-7-21-13;6-5(7,8)3-1-10-2-4(9)11-3/h5,9-10,12-14,18-19H,6-8H2,1-4H3;1-2H,(H2,9,11)/p+1/b11-5+,17-9+; |
| InChIKey | NARUNCWTVGGBDS-YGIPSXBPSA-O |
| XLogP | 0.76 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|