C20H21F3N4O6 — CID 176953400
methyl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate (PubChem CID 176953400) has the molecular formula C20H21F3N4O6 and a molecular weight of 470.40 g/mol. Its IUPAC name is methyl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 176953400 |
| Molecular Formula | C20H21F3N4O6 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | methyl 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H21F3N4O6/c1-32-19(31)11-4-2-10(3-5-11)18(30)25-6-13-17(29)16(28)12(9-33-13)26-15-8-24-7-14(27-15)20(21,22)23/h2-5,7-8,12-13,16-17,28-29H,6,9H2,1H3,(H,25,30)(H,26,27)/t12-,13+,16+,17-/m0/s1 |
| InChIKey | APVFOICJXTZVER-IXKJSCDLSA-N |
| XLogP | 0.61 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |