C32H47N3O4 — CID 176954527
(2R)-2-[[(1R,4S)-4-[4-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)butoxy]-3,3-dimethylcyclopentyl]-methylamino]-2-[(4S)-4-methyl-3,4-dihydro-2H-chromen-5-yl]acetic acid (PubChem CID 176954527) has the molecular formula C32H47N3O4 and a molecular weight of 537.75 g/mol. Its IUPAC name is (2R)-2-[[(1R,4S)-4-[4-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)butoxy]-3,3-dimethylcyclopentyl]-methylamino]-2-[(4S)-4-methyl-3,4-dihydro-2H-chromen-5-yl]acetic acid.
| Compound Name | (2R)-2-[[(1R,4S)-4-[4-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)butoxy]-3,3-dimethylcyclopentyl]-methylamino]-2-[(4S)-4-methyl-3,4-dihydro-2H-chromen-5-yl]acetic acid |
|---|---|
| PubChem CID | 176954527 |
| Molecular Formula | C32H47N3O4 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | (2R)-2-[[(1R,4S)-4-[4-(1,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-yl)butoxy]-3,3-dimethylcyclopentyl]-methylamino]-2-[(4S)-4-methyl-3,4-dihydro-2H-chromen-5-yl]acetic acid |
| SMILES | C[C@H]1CCOc2cccc([C@H](C(=O)O)N(C)[C@H]3C[C@H](OCCCCC4=CC=C5CCCNC5N4)C(C)(C)C3)c21 |
| InChI | InChI=1S/C32H47N3O4/c1-21-15-18-38-26-12-7-11-25(28(21)26)29(31(36)37)35(4)24-19-27(32(2,3)20-24)39-17-6-5-10-23-14-13-22-9-8-16-33-30(22)34-23/h7,11-14,21,24,27,29-30,33-34H,5-6,8-10,15-20H2,1-4H3,(H,36,37)/t21-,24-,27-,29+,30?/m0/s1 |
| InChIKey | HSRAXHYWPRHCNV-IBDYKNAHSA-N |
| XLogP | 5.50 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|