C32H45N3O4 — CID 176954697
(2S)-2-[[3,3-dimethyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]cyclopentyl]-methylamino]-2-[(1S)-1-methyl-3,4-dihydro-1H-isochromen-8-yl]acetic acid (PubChem CID 176954697) has the molecular formula C32H45N3O4 and a molecular weight of 535.73 g/mol. Its IUPAC name is (2S)-2-[[3,3-dimethyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]cyclopentyl]-methylamino]-2-[(1S)-1-methyl-3,4-dihydro-1H-isochromen-8-yl]acetic acid.
| Compound Name | (2S)-2-[[3,3-dimethyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]cyclopentyl]-methylamino]-2-[(1S)-1-methyl-3,4-dihydro-1H-isochromen-8-yl]acetic acid |
|---|---|
| PubChem CID | 176954697 |
| Molecular Formula | C32H45N3O4 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | (2S)-2-[[3,3-dimethyl-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]cyclopentyl]-methylamino]-2-[(1S)-1-methyl-3,4-dihydro-1H-isochromen-8-yl]acetic acid |
| SMILES | C[C@@H]1OCCc2cccc([C@@H](C(=O)O)N(C)C3CC(OCCCCc4ccc5c(n4)NCCC5)C(C)(C)C3)c21 |
| InChI | InChI=1S/C32H45N3O4/c1-21-28-22(15-18-38-21)9-7-12-26(28)29(31(36)37)35(4)25-19-27(32(2,3)20-25)39-17-6-5-11-24-14-13-23-10-8-16-33-30(23)34-24/h7,9,12-14,21,25,27,29H,5-6,8,10-11,15-20H2,1-4H3,(H,33,34)(H,36,37)/t21-,25?,27?,29-/m0/s1 |
| InChIKey | MHCUOJLZLWKSPX-XGAXKUDNSA-N |
| XLogP | 5.73 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|