C15H27N — CID 176954534
6-methyl-5-[(Z)-3-methylideneoct-1-enyl]-1,2,3,4-tetrahydropyridine;molecular hydrogen (PubChem CID 176954534) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 6-methyl-5-[(Z)-3-methylideneoct-1-enyl]-1,2,3,4-tetrahydropyridine;molecular hydrogen.
| Compound Name | 6-methyl-5-[(Z)-3-methylideneoct-1-enyl]-1,2,3,4-tetrahydropyridine;molecular hydrogen |
|---|---|
| PubChem CID | 176954534 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 6-methyl-5-[(Z)-3-methylideneoct-1-enyl]-1,2,3,4-tetrahydropyridine;molecular hydrogen |
| SMILES | C=C(/C=C\C1=C(C)NCCC1)CCCCC.[H][H] |
| InChI | InChI=1S/C15H25N.H2/c1-4-5-6-8-13(2)10-11-15-9-7-12-16-14(15)3;/h10-11,16H,2,4-9,12H2,1,3H3;1H/b11-10-; |
| InChIKey | FLQRZFIZDFRWNZ-GMFCBQQYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|