C11H16ClN — CID 143188889
6-[(1E)-2-chlorobuta-1,3-dienyl]-7-methyl-2,3,4,5-tetrahydro-1H-azepine (PubChem CID 143188889) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 6-[(1E)-2-chlorobuta-1,3-dienyl]-7-methyl-2,3,4,5-tetrahydro-1H-azepine.
| Compound Name | 6-[(1E)-2-chlorobuta-1,3-dienyl]-7-methyl-2,3,4,5-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 143188889 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 6-[(1E)-2-chlorobuta-1,3-dienyl]-7-methyl-2,3,4,5-tetrahydro-1H-azepine |
| SMILES | C=C/C(Cl)=C\C1=C(C)NCCCC1 |
| InChI | InChI=1S/C11H16ClN/c1-3-11(12)8-10-6-4-5-7-13-9(10)2/h3,8,13H,1,4-7H2,2H3/b11-8+ |
| InChIKey | KOHAUYXELQBSCA-DHZHZOJOSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|