C12H15F3 — CID 144510626
1-methyl-2-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]cyclohexene (PubChem CID 144510626) has the molecular formula C12H15F3 and a molecular weight of 216.25 g/mol. Its IUPAC name is 1-methyl-2-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]cyclohexene.
| Compound Name | 1-methyl-2-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]cyclohexene |
|---|---|
| PubChem CID | 144510626 |
| Molecular Formula | C12H15F3 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-methyl-2-[(1E)-2-(trifluoromethyl)buta-1,3-dienyl]cyclohexene |
| SMILES | C=C/C(=C\C1=C(C)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3/c1-3-11(12(13,14)15)8-10-7-5-4-6-9(10)2/h3,8H,1,4-7H2,2H3/b11-8+ |
| InChIKey | DIDMTDKKVKBXEH-DHZHZOJOSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|