C24H24B3ClFN6O4P — CID 176959024
CID 176959024 (PubChem CID 176959024) has the molecular formula C24H24B3ClFN6O4P and a molecular weight of 578.36 g/mol.
| Compound Name | CID 176959024 |
|---|---|
| PubChem CID | 176959024 |
| Molecular Formula | C24H24B3ClFN6O4P |
| Molecular Weight | 578.36 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C(/C=N/C)=C(/N)c2ccc(F)cc2[C@@]([B])(C)Oc2cc(cnc2NCOP(O)O)-c2c1c(Cl)nn2CC |
| InChI | InChI=1S/C24H24B3ClFN6O4P/c1-4-35-20-12-7-17(22(32-9-12)33-11-38-40(36)37)39-23(2,25)15-8-13(29)5-6-14(15)19(30)16(10-31-3)24(26,27)18(20)21(28)34-35/h5-10,36-37H,4,11,30H2,1-3H3,(H,32,33)/b19-16+,31-10+/t23-/m1/s1 |
| InChIKey | SMCMZRNKCXFTAX-RTEXQHQTSA-N |
| XLogP | 2.65 |
| TPSA | 140.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|