C11H18N2O4S — CID 176960455
[(2E)-2-ethenylpenta-2,4-dienyl] N-(propan-2-ylsulfamoyl)carbamate (PubChem CID 176960455) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] N-(propan-2-ylsulfamoyl)carbamate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-(propan-2-ylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 176960455 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-(propan-2-ylsulfamoyl)carbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)NS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C11H18N2O4S/c1-5-7-10(6-2)8-17-11(14)13-18(15,16)12-9(3)4/h5-7,9,12H,1-2,8H2,3-4H3,(H,13,14)/b10-7+ |
| InChIKey | RJYHNPUABYQTHO-JXMROGBWSA-N |
| XLogP | 1.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|