C19H33NO6 — CID 144950441
ethane;5-O-[(2E)-2-ethenylpenta-2,4-dienyl] 1-O-methyl pentanedioate;propan-2-yl carbamate (PubChem CID 144950441) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is ethane;5-O-[(2E)-2-ethenylpenta-2,4-dienyl] 1-O-methyl pentanedioate;propan-2-yl carbamate.
| Compound Name | ethane;5-O-[(2E)-2-ethenylpenta-2,4-dienyl] 1-O-methyl pentanedioate;propan-2-yl carbamate |
|---|---|
| PubChem CID | 144950441 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | ethane;5-O-[(2E)-2-ethenylpenta-2,4-dienyl] 1-O-methyl pentanedioate;propan-2-yl carbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)CCCC(=O)OC.CC.CC(C)OC(N)=O |
| InChI | InChI=1S/C13H18O4.C4H9NO2.C2H6/c1-4-7-11(5-2)10-17-13(15)9-6-8-12(14)16-3;1-3(2)7-4(5)6;1-2/h4-5,7H,1-2,6,8-10H2,3H3;3H,1-2H3,(H2,5,6);1-2H3/b11-7+;; |
| InChIKey | PEWIZRJCISGRSY-FCVAESPPSA-N |
| XLogP | 3.69 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|